C20H23F3O2 — CID 154720829
(5R)-5-(4-methylphenyl)-3,4-dipropyl-5-[(E)-3,3,3-trifluoroprop-1-enyl]furan-2-one (PubChem CID 154720829) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (5R)-5-(4-methylphenyl)-3,4-dipropyl-5-[(E)-3,3,3-trifluoroprop-1-enyl]furan-2-one.
| Compound Name | (5R)-5-(4-methylphenyl)-3,4-dipropyl-5-[(E)-3,3,3-trifluoroprop-1-enyl]furan-2-one |
|---|---|
| PubChem CID | 154720829 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (5R)-5-(4-methylphenyl)-3,4-dipropyl-5-[(E)-3,3,3-trifluoroprop-1-enyl]furan-2-one |
| SMILES | CCCC1=C(CCC)[C@@](/C=C/C(F)(F)F)(c2ccc(C)cc2)OC1=O |
| InChI | InChI=1S/C20H23F3O2/c1-4-6-16-17(7-5-2)19(25-18(16)24,12-13-20(21,22)23)15-10-8-14(3)9-11-15/h8-13H,4-7H2,1-3H3/b13-12+/t19-/m1/s1 |
| InChIKey | PFCYMDHZGOFSOG-JXOMPUQVSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|