C34H21F6N5 — CID 154720844
9-benzyl-6-[2,3-bis[4-(trifluoromethyl)phenyl]indol-1-yl]purine (PubChem CID 154720844) has the molecular formula C34H21F6N5 and a molecular weight of 613.57 g/mol. Its IUPAC name is 9-benzyl-6-[2,3-bis[4-(trifluoromethyl)phenyl]indol-1-yl]purine.
| Compound Name | 9-benzyl-6-[2,3-bis[4-(trifluoromethyl)phenyl]indol-1-yl]purine |
|---|---|
| PubChem CID | 154720844 |
| Molecular Formula | C34H21F6N5 |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 9-benzyl-6-[2,3-bis[4-(trifluoromethyl)phenyl]indol-1-yl]purine |
| SMILES | FC(F)(F)c1ccc(-c2c(-c3ccc(C(F)(F)F)cc3)n(-c3ncnc4c3ncn4Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C34H21F6N5/c35-33(36,37)24-14-10-22(11-15-24)28-26-8-4-5-9-27(26)45(30(28)23-12-16-25(17-13-23)34(38,39)40)32-29-31(41-19-42-32)44(20-43-29)18-21-6-2-1-3-7-21/h1-17,19-20H,18H2 |
| InChIKey | MSSXFGMGVMSCPT-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |