C14H11NOS — CID 154720957
4-methyl-14-oxa-3-thia-7-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,7,9,11(15)-hexaene (PubChem CID 154720957) has the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. Its IUPAC name is 4-methyl-14-oxa-3-thia-7-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,7,9,11(15)-hexaene.
| Compound Name | 4-methyl-14-oxa-3-thia-7-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,7,9,11(15)-hexaene |
|---|---|
| PubChem CID | 154720957 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-methyl-14-oxa-3-thia-7-azatetracyclo[7.7.0.02,6.011,15]hexadeca-1(16),2(6),4,7,9,11(15)-hexaene |
| SMILES | Cc1cc2ncc3cc4c(cc3c2s1)OCC4 |
| InChI | InChI=1S/C14H11NOS/c1-8-4-12-14(17-8)11-6-13-9(2-3-16-13)5-10(11)7-15-12/h4-7H,2-3H2,1H3 |
| InChIKey | CYTLHPRMSTUHQF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |