C18H24F3NO2 — CID 154721150
2,2,2-trifluoro-N-[(1S,2S)-1-[(3S)-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide (PubChem CID 154721150) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,2S)-1-[(3S)-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S,2S)-1-[(3S)-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 154721150 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,2S)-1-[(3S)-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide |
| SMILES | C=CC[C@](C)(CC)O[C@@H](c1ccccc1)[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H24F3NO2/c1-5-12-17(4,6-2)24-15(14-10-8-7-9-11-14)13(3)22-16(23)18(19,20)21/h5,7-11,13,15H,1,6,12H2,2-4H3,(H,22,23)/t13-,15+,17-/m0/s1 |
| InChIKey | FXHONEFMAFIFIH-LXZKKBNFSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|