About methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate
methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate (PubChem CID 154721156) has the molecular formula C18H34O2Si
and a molecular weight of 310.55 g/mol. Its IUPAC name is methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate.
Molecular Properties
| Compound Name | methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate |
| PubChem CID | 154721156 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate |
| SMILES | COC(=O)C(/C(=C\C(C)(C)C)C1CCCCC1)[Si](C)(C)C |
| InChI | InChI=1S/C18H34O2Si/c1-18(2,3)13-15(14-11-9-8-10-12-14)16(17(19)20-4)21(5,6)7/h13-14,16H,8-12H2,1-7H3/b15-13- |
| InChIKey | DFZFNSYLRPPQIL-SQFISAMPSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate?
The IUPAC name of methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate (CID 154721156) is methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate.
What is the SMILES notation for methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate?
The canonical SMILES for methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate is COC(=O)C(/C(=C\C(C)(C)C)C1CCCCC1)[Si](C)(C)C.
What is the InChIKey of methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate?
The InChIKey is DFZFNSYLRPPQIL-SQFISAMPSA-N. The full InChI is InChI=1S/C18H34O2Si/c1-18(2,3)13-15(14-11-9-8-10-12-14)16(17(19)20-4)21(5,6)7/h13-14,16H,8-12H2,1-7H3/b15-13-.
What are the key properties of methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate?
methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate has a molecular weight of 310.55 g/mol, XLogP of 5.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-cyclohexyl-5,5-dimethyl-2-trimethylsilylhex-3-enoate is sourced from PubChem (CID 154721156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).