C18H35BO5Si — CID 154721161
[(Z)-5-[dimethyl(propan-2-yloxy)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl] acetate (PubChem CID 154721161) has the molecular formula C18H35BO5Si and a molecular weight of 370.37 g/mol. Its IUPAC name is [(Z)-5-[dimethyl(propan-2-yloxy)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl] acetate.
| Compound Name | [(Z)-5-[dimethyl(propan-2-yloxy)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl] acetate |
|---|---|
| PubChem CID | 154721161 |
| Molecular Formula | C18H35BO5Si |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | [(Z)-5-[dimethyl(propan-2-yloxy)silyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl] acetate |
| SMILES | CC(=O)OCC/C=C(\C[Si](C)(C)OC(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H35BO5Si/c1-14(2)22-25(8,9)13-16(11-10-12-21-15(3)20)19-23-17(4,5)18(6,7)24-19/h11,14H,10,12-13H2,1-9H3/b16-11+ |
| InChIKey | VSVWCJZONUKZMR-LFIBNONCSA-N |
| XLogP | 4.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|