C22H34BNO3 — CID 154721180
(3R,4R)-4-phenyl-1-pyrrolidin-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-one (PubChem CID 154721180) has the molecular formula C22H34BNO3 and a molecular weight of 371.33 g/mol. Its IUPAC name is (3R,4R)-4-phenyl-1-pyrrolidin-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-one.
| Compound Name | (3R,4R)-4-phenyl-1-pyrrolidin-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 154721180 |
| Molecular Formula | C22H34BNO3 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | (3R,4R)-4-phenyl-1-pyrrolidin-1-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexan-1-one |
| SMILES | CC[C@@H](c1ccccc1)[C@@H](CC(=O)N1CCCC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34BNO3/c1-6-18(17-12-8-7-9-13-17)19(16-20(25)24-14-10-11-15-24)23-26-21(2,3)22(4,5)27-23/h7-9,12-13,18-19H,6,10-11,14-16H2,1-5H3/t18-,19+/m0/s1 |
| InChIKey | QRNCEFRNBVKRKM-RBUKOAKNSA-N |
| XLogP | 4.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|