C22H18F2N4O3 — CID 154721221
2-[3-[3-(difluoromethyl)-6-(4-methylphenyl)-5-oxo-1,2,4-triazin-4-yl]propyl]isoindole-1,3-dione (PubChem CID 154721221) has the molecular formula C22H18F2N4O3 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-[3-[3-(difluoromethyl)-6-(4-methylphenyl)-5-oxo-1,2,4-triazin-4-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-(difluoromethyl)-6-(4-methylphenyl)-5-oxo-1,2,4-triazin-4-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154721221 |
| Molecular Formula | C22H18F2N4O3 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[3-[3-(difluoromethyl)-6-(4-methylphenyl)-5-oxo-1,2,4-triazin-4-yl]propyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2nnc(C(F)F)n(CCCN3C(=O)c4ccccc4C3=O)c2=O)cc1 |
| InChI | InChI=1S/C22H18F2N4O3/c1-13-7-9-14(10-8-13)17-22(31)27(19(18(23)24)26-25-17)11-4-12-28-20(29)15-5-2-3-6-16(15)21(28)30/h2-3,5-10,18H,4,11-12H2,1H3 |
| InChIKey | QIEINIWRPDBHBB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|