About 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one
3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one (PubChem CID 154721226) has the molecular formula C19H24ClF2N3O
and a molecular weight of 383.87 g/mol. Its IUPAC name is 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one |
| PubChem CID | 154721226 |
| Molecular Formula | C19H24ClF2N3O |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one |
| SMILES | CCCCCCc1nnc(C(F)(F)Cl)n(CCCc2ccccc2)c1=O |
| InChI | InChI=1S/C19H24ClF2N3O/c1-2-3-4-8-13-16-17(26)25(18(24-23-16)19(20,21)22)14-9-12-15-10-6-5-7-11-15/h5-7,10-11H,2-4,8-9,12-14H2,1H3 |
| InChIKey | YHPXNVMXEHWJHS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one?
The IUPAC name of 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one (CID 154721226) is 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one.
What is the SMILES notation for 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one?
The canonical SMILES for 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one is CCCCCCc1nnc(C(F)(F)Cl)n(CCCc2ccccc2)c1=O.
What is the InChIKey of 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one?
The InChIKey is YHPXNVMXEHWJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24ClF2N3O/c1-2-3-4-8-13-16-17(26)25(18(24-23-16)19(20,21)22)14-9-12-15-10-6-5-7-11-15/h5-7,10-11H,2-4,8-9,12-14H2,1H3.
What are the key properties of 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one?
3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one has a molecular weight of 383.87 g/mol, XLogP of 4.68, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro(difluoro)methyl]-6-hexyl-4-(3-phenylpropyl)-1,2,4-triazin-5-one is sourced from PubChem (CID 154721226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).