About methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate
methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate (PubChem CID 154721242) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate |
| PubChem CID | 154721242 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate |
| SMILES | CC/C=C/[C@H](CC)NCC(=O)OC |
| InChI | InChI=1S/C10H19NO2/c1-4-6-7-9(5-2)11-8-10(12)13-3/h6-7,9,11H,4-5,8H2,1-3H3/b7-6+/t9-/m0/s1 |
| InChIKey | RZHKDKRBBOMEGK-UCUJLANTSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate?
The IUPAC name of methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate (CID 154721242) is methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate.
What is the SMILES notation for methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate?
The canonical SMILES for methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate is CC/C=C/[C@H](CC)NCC(=O)OC.
What is the InChIKey of methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate?
The InChIKey is RZHKDKRBBOMEGK-UCUJLANTSA-N. The full InChI is InChI=1S/C10H19NO2/c1-4-6-7-9(5-2)11-8-10(12)13-3/h6-7,9,11H,4-5,8H2,1-3H3/b7-6+/t9-/m0/s1.
What are the key properties of methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate?
methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate has a molecular weight of 185.27 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(E,3S)-hept-4-en-3-yl]amino]acetate is sourced from PubChem (CID 154721242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).