C16H20O9 — CID 154721276
[(3S,6S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate (PubChem CID 154721276) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is [(3S,6S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate.
| Compound Name | [(3S,6S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 154721276 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [(3S,6S)-4,5,6-triacetyloxy-2-prop-2-ynyloxan-3-yl] acetate |
| SMILES | C#CCC1O[C@@H](OC(C)=O)C(OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H20O9/c1-6-7-12-13(21-8(2)17)14(22-9(3)18)15(23-10(4)19)16(25-12)24-11(5)20/h1,12-16H,7H2,2-5H3/t12?,13-,14?,15?,16+/m0/s1 |
| InChIKey | PQRBJNAJCNCVPG-XDSFWISGSA-N |
| XLogP | 0.09 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|