C44H38O6Se2 — CID 154721299
[(1S)-7-methoxy-8-[[(8S)-2-methoxy-8-(naphthalene-2-carbonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]diselanyl]-1,2,3,4-tetrahydronaphthalen-1-yl] naphthalene-2-carboxylate (PubChem CID 154721299) has the molecular formula C44H38O6Se2 and a molecular weight of 820.70 g/mol. Its IUPAC name is [(1S)-7-methoxy-8-[[(8S)-2-methoxy-8-(naphthalene-2-carbonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]diselanyl]-1,2,3,4-tetrahydronaphthalen-1-yl] naphthalene-2-carboxylate.
| Compound Name | [(1S)-7-methoxy-8-[[(8S)-2-methoxy-8-(naphthalene-2-carbonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]diselanyl]-1,2,3,4-tetrahydronaphthalen-1-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 154721299 |
| Molecular Formula | C44H38O6Se2 |
| Molecular Weight | 820.70 g/mol |
| Exact Mass | 822.10 |
| IUPAC Name | [(1S)-7-methoxy-8-[[(8S)-2-methoxy-8-(naphthalene-2-carbonyloxy)-5,6,7,8-tetrahydronaphthalen-1-yl]diselanyl]-1,2,3,4-tetrahydronaphthalen-1-yl] naphthalene-2-carboxylate |
| SMILES | COc1ccc2c(c1[Se][Se]c1c(OC)ccc3c1[C@@H](OC(=O)c1ccc4ccccc4c1)CCC3)[C@@H](OC(=O)c1ccc3ccccc3c1)CCC2 |
| InChI | InChI=1S/C44H38O6Se2/c1-47-37-23-21-29-13-7-15-35(49-43(45)33-19-17-27-9-3-5-11-31(27)25-33)39(29)41(37)51-52-42-38(48-2)24-22-30-14-8-16-36(40(30)42)50-44(46)34-20-18-28-10-4-6-12-32(28)26-34/h3-6,9-12,17-26,35-36H,7-8,13-16H2,1-2H3/t35-,36-/m0/s1 |
| InChIKey | FXIZNSPMRKGUHR-ZPGRZCPFSA-N |
| XLogP | 7.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.70 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|