About benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate
benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 154721312) has the molecular formula C24H25NO6S
and a molecular weight of 455.53 g/mol. Its IUPAC name is benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate |
| PubChem CID | 154721312 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | COc1ccc([C@H](NS(=O)(=O)c2ccc(C)cc2)C(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H25NO6S/c1-17-9-12-20(13-10-17)32(27,28)25-23(19-11-14-21(29-2)22(15-19)30-3)24(26)31-16-18-7-5-4-6-8-18/h4-15,23,25H,16H2,1-3H3/t23-/m0/s1 |
| InChIKey | NFXAIUGGFLRYRV-QHCPKHFHSA-N |
| XLogP | 3.78 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate?
The IUPAC name of benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate (CID 154721312) is benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate.
What is the SMILES notation for benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate?
The canonical SMILES for benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate is COc1ccc([C@H](NS(=O)(=O)c2ccc(C)cc2)C(=O)OCc2ccccc2)cc1OC.
What is the InChIKey of benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate?
The InChIKey is NFXAIUGGFLRYRV-QHCPKHFHSA-N. The full InChI is InChI=1S/C24H25NO6S/c1-17-9-12-20(13-10-17)32(27,28)25-23(19-11-14-21(29-2)22(15-19)30-3)24(26)31-16-18-7-5-4-6-8-18/h4-15,23,25H,16H2,1-3H3/t23-/m0/s1.
What are the key properties of benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate?
benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate has a molecular weight of 455.53 g/mol, XLogP of 3.78, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-(3,4-dimethoxyphenyl)-2-[(4-methylphenyl)sulfonylamino]acetate is sourced from PubChem (CID 154721312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).