C30H54O2Si — CID 154721325
(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol (PubChem CID 154721325) has the molecular formula C30H54O2Si and a molecular weight of 474.85 g/mol. Its IUPAC name is (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol.
| Compound Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol |
|---|---|
| PubChem CID | 154721325 |
| Molecular Formula | C30H54O2Si |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-triethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCO)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H54O2Si/c1-7-33(8-2,9-3)32-24-16-18-29(5)23(21-24)12-13-25-27-15-14-26(22(4)11-10-20-31)30(27,6)19-17-28(25)29/h12,22,24-28,31H,7-11,13-21H2,1-6H3/t22-,24+,25+,26-,27+,28+,29+,30-/m1/s1 |
| InChIKey | IJMCARMIDZPYJO-OCBUSCMESA-N |
| XLogP | 8.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|