About methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate
methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate (PubChem CID 154721601) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate |
| PubChem CID | 154721601 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate |
| SMILES | CC/C=C/[C@H](CC)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C14H27NO2/c1-6-8-9-12(7-2)15-13(10-11(3)4)14(16)17-5/h8-9,11-13,15H,6-7,10H2,1-5H3/b9-8+/t12-,13-/m0/s1 |
| InChIKey | CRSDBCPLNVQDIX-TYDXBBDOSA-N |
| XLogP | 2.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate?
The IUPAC name of methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate (CID 154721601) is methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate.
What is the SMILES notation for methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate?
The canonical SMILES for methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate is CC/C=C/[C@H](CC)N[C@@H](CC(C)C)C(=O)OC.
What is the InChIKey of methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate?
The InChIKey is CRSDBCPLNVQDIX-TYDXBBDOSA-N. The full InChI is InChI=1S/C14H27NO2/c1-6-8-9-12(7-2)15-13(10-11(3)4)14(16)17-5/h8-9,11-13,15H,6-7,10H2,1-5H3/b9-8+/t12-,13-/m0/s1.
What are the key properties of methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate?
methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate has a molecular weight of 241.37 g/mol, XLogP of 2.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(E,3S)-hept-4-en-3-yl]amino]-4-methylpentanoate is sourced from PubChem (CID 154721601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).