C24H40O3Si — CID 154721621
(1E,3R,10R,11S,14R)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one (PubChem CID 154721621) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is (1E,3R,10R,11S,14R)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one.
| Compound Name | (1E,3R,10R,11S,14R)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one |
|---|---|
| PubChem CID | 154721621 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (1E,3R,10R,11S,14R)-14-(methoxymethyl)-3,10-dimethyl-6-propan-2-yl-14-trimethylsilyloxytricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one |
| SMILES | COC[C@@]1(O[Si](C)(C)C)CC[C@@H]2/C1=C\[C@@]1(C)CCC(C(C)C)=C1CC(=O)[C@@H]2C |
| InChI | InChI=1S/C24H40O3Si/c1-16(2)18-9-11-23(4)14-21-19(17(3)22(25)13-20(18)23)10-12-24(21,15-26-5)27-28(6,7)8/h14,16-17,19H,9-13,15H2,1-8H3/b21-14+/t17-,19+,23-,24+/m1/s1 |
| InChIKey | OCDWLEFXFQPHDT-YVFKSDBBSA-N |
| XLogP | 5.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|