C21H23F2N3O4 — CID 154721753
methyl (2S,3R,6R)-2-[2-[1-[(2,4-difluorophenyl)methyl]triazol-4-yl]ethyl]-3,6-dimethyl-5-methylidene-4-oxooxane-3-carboxylate (PubChem CID 154721753) has the molecular formula C21H23F2N3O4 and a molecular weight of 419.43 g/mol. Its IUPAC name is methyl (2S,3R,6R)-2-[2-[1-[(2,4-difluorophenyl)methyl]triazol-4-yl]ethyl]-3,6-dimethyl-5-methylidene-4-oxooxane-3-carboxylate.
| Compound Name | methyl (2S,3R,6R)-2-[2-[1-[(2,4-difluorophenyl)methyl]triazol-4-yl]ethyl]-3,6-dimethyl-5-methylidene-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 154721753 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | methyl (2S,3R,6R)-2-[2-[1-[(2,4-difluorophenyl)methyl]triazol-4-yl]ethyl]-3,6-dimethyl-5-methylidene-4-oxooxane-3-carboxylate |
| SMILES | C=C1C(=O)[C@](C)(C(=O)OC)[C@H](CCc2cn(Cc3ccc(F)cc3F)nn2)O[C@@H]1C |
| InChI | InChI=1S/C21H23F2N3O4/c1-12-13(2)30-18(21(3,19(12)27)20(28)29-4)8-7-16-11-26(25-24-16)10-14-5-6-15(22)9-17(14)23/h5-6,9,11,13,18H,1,7-8,10H2,2-4H3/t13-,18+,21-/m1/s1 |
| InChIKey | UZKBCLDEHDJWHW-LZHZSBQWSA-N |
| XLogP | 2.63 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|