C17H15F5N2O2 — CID 154721793
2-anilino-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propanamide (PubChem CID 154721793) has the molecular formula C17H15F5N2O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-anilino-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propanamide.
| Compound Name | 2-anilino-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 154721793 |
| Molecular Formula | C17H15F5N2O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-anilino-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]propanamide |
| SMILES | CC(C)(Nc1ccccc1)C(=O)NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H15F5N2O2/c1-17(2,23-9-6-4-3-5-7-9)16(25)24-26-8-10-11(18)13(20)15(22)14(21)12(10)19/h3-7,23H,8H2,1-2H3,(H,24,25) |
| InChIKey | WECXFHKLNMVNTI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|