C13H18O4 — CID 154721956
methyl (2S,3R,6R)-2-but-3-ynyl-3,6-dimethyl-4-oxooxane-3-carboxylate (PubChem CID 154721956) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is methyl (2S,3R,6R)-2-but-3-ynyl-3,6-dimethyl-4-oxooxane-3-carboxylate.
| Compound Name | methyl (2S,3R,6R)-2-but-3-ynyl-3,6-dimethyl-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 154721956 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | methyl (2S,3R,6R)-2-but-3-ynyl-3,6-dimethyl-4-oxooxane-3-carboxylate |
| SMILES | C#CCC[C@@H]1O[C@H](C)CC(=O)[C@]1(C)C(=O)OC |
| InChI | InChI=1S/C13H18O4/c1-5-6-7-11-13(3,12(15)16-4)10(14)8-9(2)17-11/h1,9,11H,6-8H2,2-4H3/t9-,11+,13+/m1/s1 |
| InChIKey | LBZSPFYUZVEJQU-CDMKHQONSA-N |
| XLogP | 1.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|