C27H24F4IN3O2 — CID 154721967
N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-2,3,4,5-tetrafluoro-6-iodobenzamide (PubChem CID 154721967) has the molecular formula C27H24F4IN3O2 and a molecular weight of 625.40 g/mol. Its IUPAC name is N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-2,3,4,5-tetrafluoro-6-iodobenzamide.
| Compound Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-2,3,4,5-tetrafluoro-6-iodobenzamide |
|---|---|
| PubChem CID | 154721967 |
| Molecular Formula | C27H24F4IN3O2 |
| Molecular Weight | 625.40 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | N-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-(6-methoxyquinolin-4-yl)methyl]-2,3,4,5-tetrafluoro-6-iodobenzamide |
| SMILES | C=CC1CN2CCC1CC2[C@@H](NC(=O)c1c(F)c(F)c(F)c(F)c1I)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C27H24F4IN3O2/c1-3-13-12-35-9-7-14(13)10-19(35)26(16-6-8-33-18-5-4-15(37-2)11-17(16)18)34-27(36)20-21(28)22(29)23(30)24(31)25(20)32/h3-6,8,11,13-14,19,26H,1,7,9-10,12H2,2H3,(H,34,36)/t13?,14?,19?,26-/m0/s1 |
| InChIKey | RHQGIQHEYSYTQT-WLEGDHCDSA-N |
| XLogP | 5.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|