C17H19F3O5S — CID 154722034
[3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] trifluoromethanesulfonate (PubChem CID 154722034) has the molecular formula C17H19F3O5S and a molecular weight of 392.40 g/mol. Its IUPAC name is [3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154722034 |
| Molecular Formula | C17H19F3O5S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [3,5-dihydroxy-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]phenyl] trifluoromethanesulfonate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(OS(=O)(=O)C(F)(F)F)cc1O |
| InChI | InChI=1S/C17H19F3O5S/c1-9(2)12-5-4-10(3)6-13(12)16-14(21)7-11(8-15(16)22)25-26(23,24)17(18,19)20/h6-8,12-13,21-22H,1,4-5H2,2-3H3/t12-,13+/m0/s1 |
| InChIKey | JHZHNWFWYSYSBX-QWHCGFSZSA-N |
| XLogP | 4.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|