C28H22N6O8S2 — CID 154722122
1,4-bis-(4-methylphenyl)sulfonyl-3,6-bis(2-nitrophenyl)-1,2,4,5-tetrazine (PubChem CID 154722122) has the molecular formula C28H22N6O8S2 and a molecular weight of 634.65 g/mol. Its IUPAC name is 1,4-bis-(4-methylphenyl)sulfonyl-3,6-bis(2-nitrophenyl)-1,2,4,5-tetrazine.
| Compound Name | 1,4-bis-(4-methylphenyl)sulfonyl-3,6-bis(2-nitrophenyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 154722122 |
| Molecular Formula | C28H22N6O8S2 |
| Molecular Weight | 634.65 g/mol |
| Exact Mass | 634.09 |
| IUPAC Name | 1,4-bis-(4-methylphenyl)sulfonyl-3,6-bis(2-nitrophenyl)-1,2,4,5-tetrazine |
| SMILES | Cc1ccc(S(=O)(=O)N2N=C(c3ccccc3[N+](=O)[O-])N(S(=O)(=O)c3ccc(C)cc3)N=C2c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H22N6O8S2/c1-19-11-15-21(16-12-19)43(39,40)31-27(23-7-3-5-9-25(23)33(35)36)30-32(44(41,42)22-17-13-20(2)14-18-22)28(29-31)24-8-4-6-10-26(24)34(37)38/h3-18H,1-2H3 |
| InChIKey | NMJJCBAPNQKBPD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 185.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|