About 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde
7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde (PubChem CID 15472219) has the molecular formula C11H8N4O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde.
Molecular Properties
| Compound Name | 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde |
| PubChem CID | 15472219 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde |
| SMILES | Cc1ccc2c(c1)cc(C=O)c1nnnn12 |
| InChI | InChI=1S/C11H8N4O/c1-7-2-3-10-8(4-7)5-9(6-16)11-12-13-14-15(10)11/h2-6H,1H3 |
| InChIKey | WUOCICMMELPZKA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde?
The IUPAC name of 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde (CID 15472219) is 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde.
What is the SMILES notation for 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde?
The canonical SMILES for 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde is Cc1ccc2c(c1)cc(C=O)c1nnnn12.
What is the InChIKey of 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde?
The InChIKey is WUOCICMMELPZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O/c1-7-2-3-10-8(4-7)5-9(6-16)11-12-13-14-15(10)11/h2-6H,1H3.
What are the key properties of 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde?
7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde has a molecular weight of 212.21 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyltetrazolo[1,5-a]quinoline-4-carbaldehyde is sourced from PubChem (CID 15472219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).