About tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane
tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane (PubChem CID 154722360) has the molecular formula C16H33IOSi
and a molecular weight of 396.43 g/mol. Its IUPAC name is tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane |
| PubChem CID | 154722360 |
| Molecular Formula | C16H33IOSi |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane |
| SMILES | CCCC/C=C\[C@H](CC(C)I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33IOSi/c1-8-9-10-11-12-15(13-14(2)17)18-19(6,7)16(3,4)5/h11-12,14-15H,8-10,13H2,1-7H3/b12-11-/t14?,15-/m1/s1 |
| InChIKey | ROZFZFFTZFBVEF-YTWZOHJSSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane (CID 154722360) is tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane is CCCC/C=C\[C@H](CC(C)I)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane?
The InChIKey is ROZFZFFTZFBVEF-YTWZOHJSSA-N. The full InChI is InChI=1S/C16H33IOSi/c1-8-9-10-11-12-15(13-14(2)17)18-19(6,7)16(3,4)5/h11-12,14-15H,8-10,13H2,1-7H3/b12-11-/t14?,15-/m1/s1.
What are the key properties of tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane?
tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane has a molecular weight of 396.43 g/mol, XLogP of 6.34, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z,4S)-2-iododec-5-en-4-yl]oxy-dimethylsilane is sourced from PubChem (CID 154722360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).