C14H16Li2N2 — CID 154722414
dilithium;1-N,1-N,8-N,8-N-tetramethyl-4,5-dihydronaphthalene-4,5-diide-1,8-diamine (PubChem CID 154722414) has the molecular formula C14H16Li2N2 and a molecular weight of 226.18 g/mol. Its IUPAC name is dilithium;1-N,1-N,8-N,8-N-tetramethyl-4,5-dihydronaphthalene-4,5-diide-1,8-diamine.
| Compound Name | dilithium;1-N,1-N,8-N,8-N-tetramethyl-4,5-dihydronaphthalene-4,5-diide-1,8-diamine |
|---|---|
| PubChem CID | 154722414 |
| Molecular Formula | C14H16Li2N2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | dilithium;1-N,1-N,8-N,8-N-tetramethyl-4,5-dihydronaphthalene-4,5-diide-1,8-diamine |
| SMILES | CN(C)c1cc[c-]c2[c-]ccc(N(C)C)c12.[Li+].[Li+] |
| InChI | InChI=1S/C14H16N2.2Li/c1-15(2)12-9-5-7-11-8-6-10-13(14(11)12)16(3)4;;/h5-6,9-10H,1-4H3;;/q-2;2*+1 |
| InChIKey | NDVVPFLZBVAOHW-UHFFFAOYSA-N |
| XLogP | -3.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|