C19H33IOSi — CID 154722619
tert-butyl-[(3R,4R,5S)-5-iodo-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane (PubChem CID 154722619) has the molecular formula C19H33IOSi and a molecular weight of 432.46 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5S)-5-iodo-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5S)-5-iodo-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 154722619 |
| Molecular Formula | C19H33IOSi |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | tert-butyl-[(3R,4R,5S)-5-iodo-4-methyl-1-phenylhexan-3-yl]oxy-dimethylsilane |
| SMILES | C[C@@H]([C@H](C)I)[C@@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33IOSi/c1-15(16(2)20)18(21-22(6,7)19(3,4)5)14-13-17-11-9-8-10-12-17/h8-12,15-16,18H,13-14H2,1-7H3/t15-,16-,18+/m0/s1 |
| InChIKey | QVBPIXMMWMCVAR-XYJFISCASA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|