(3S,4S)-4-methyloxolane-3-carboxylic acid

C6H10O3 — CID 154722822

IUPAC(3S,4S)-4-methyloxolane-3-carboxylic acid
SMILESC[C@@H]1COC[C@H]1C(=O)O
InChIInChI=1S/C6H10O3/c1-4-2-9-3-5(4)6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/t4-,5-/m1/s1
InChIKeyHYFLJRAKYMMEEJ-RFZPGFLSSA-N
MW130.14 g/mol
LogP0.35
Rot. Bonds1

About (3S,4S)-4-methyloxolane-3-carboxylic acid

(3S,4S)-4-methyloxolane-3-carboxylic acid (PubChem CID 154722822) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (3S,4S)-4-methyloxolane-3-carboxylic acid.

Molecular Properties

Compound Name(3S,4S)-4-methyloxolane-3-carboxylic acid
PubChem CID154722822
Molecular FormulaC6H10O3
Molecular Weight130.14 g/mol
Exact Mass130.06
IUPAC Name(3S,4S)-4-methyloxolane-3-carboxylic acid
SMILESC[C@@H]1COC[C@H]1C(=O)O
InChIInChI=1S/C6H10O3/c1-4-2-9-3-5(4)6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/t4-,5-/m1/s1
InChIKeyHYFLJRAKYMMEEJ-RFZPGFLSSA-N
XLogP0.35
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.14
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3S,4S)-4-methyloxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4S)-4-methyloxolane-3-carboxylic acid?
The IUPAC name of (3S,4S)-4-methyloxolane-3-carboxylic acid (CID 154722822) is (3S,4S)-4-methyloxolane-3-carboxylic acid.
What is the SMILES notation for (3S,4S)-4-methyloxolane-3-carboxylic acid?
The canonical SMILES for (3S,4S)-4-methyloxolane-3-carboxylic acid is C[C@@H]1COC[C@H]1C(=O)O.
What is the InChIKey of (3S,4S)-4-methyloxolane-3-carboxylic acid?
The InChIKey is HYFLJRAKYMMEEJ-RFZPGFLSSA-N. The full InChI is InChI=1S/C6H10O3/c1-4-2-9-3-5(4)6(7)8/h4-5H,2-3H2,1H3,(H,7,8)/t4-,5-/m1/s1.
What are the key properties of (3S,4S)-4-methyloxolane-3-carboxylic acid?
(3S,4S)-4-methyloxolane-3-carboxylic acid has a molecular weight of 130.14 g/mol, XLogP of 0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-methyloxolane-3-carboxylic acid is sourced from PubChem (CID 154722822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).