C21H14F3NO2S — CID 154722869
1-(4-methylphenyl)sulfonyl-5-(2,4,6-trifluorophenyl)indole (PubChem CID 154722869) has the molecular formula C21H14F3NO2S and a molecular weight of 401.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5-(2,4,6-trifluorophenyl)indole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5-(2,4,6-trifluorophenyl)indole |
|---|---|
| PubChem CID | 154722869 |
| Molecular Formula | C21H14F3NO2S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5-(2,4,6-trifluorophenyl)indole |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3cc(-c4c(F)cc(F)cc4F)ccc32)cc1 |
| InChI | InChI=1S/C21H14F3NO2S/c1-13-2-5-17(6-3-13)28(26,27)25-9-8-14-10-15(4-7-20(14)25)21-18(23)11-16(22)12-19(21)24/h2-12H,1H3 |
| InChIKey | VHFKWLPFQASFGB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |