C20H28O2 — CID 154722961
(6S,8aS)-5,5,8a-trimethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 154722961) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (6S,8aS)-5,5,8a-trimethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (6S,8aS)-5,5,8a-trimethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 154722961 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (6S,8aS)-5,5,8a-trimethyl-6-phenylmethoxy-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)C2CCCC(=O)[C@@]2(C)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H28O2/c1-19(2)16-10-7-11-17(21)20(16,3)13-12-18(19)22-14-15-8-5-4-6-9-15/h4-6,8-9,16,18H,7,10-14H2,1-3H3/t16?,18-,20-/m0/s1 |
| InChIKey | YSISSTFNMGEALA-WNPSOCMYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |