C19H42O6Si2 — CID 154723345
ethyl 4,4-bis(triethylsilylperoxy)pentanoate (PubChem CID 154723345) has the molecular formula C19H42O6Si2 and a molecular weight of 422.71 g/mol. Its IUPAC name is ethyl 4,4-bis(triethylsilylperoxy)pentanoate.
| Compound Name | ethyl 4,4-bis(triethylsilylperoxy)pentanoate |
|---|---|
| PubChem CID | 154723345 |
| Molecular Formula | C19H42O6Si2 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | ethyl 4,4-bis(triethylsilylperoxy)pentanoate |
| SMILES | CCOC(=O)CCC(C)(OO[Si](CC)(CC)CC)OO[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H42O6Si2/c1-9-21-18(20)16-17-19(8,22-24-26(10-2,11-3)12-4)23-25-27(13-5,14-6)15-7/h9-17H2,1-8H3 |
| InChIKey | WCKDSHUJXYBIMB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|