C13H10F16O4 — CID 15472345
2,2-dimethyl-4-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-dioxolane (PubChem CID 15472345) has the molecular formula C13H10F16O4 and a molecular weight of 534.19 g/mol. Its IUPAC name is 2,2-dimethyl-4-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-dioxolane.
| Compound Name | 2,2-dimethyl-4-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 15472345 |
| Molecular Formula | C13H10F16O4 |
| Molecular Weight | 534.19 g/mol |
| Exact Mass | 534.03 |
| IUPAC Name | 2,2-dimethyl-4-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-dioxolane |
| SMILES | CC1(C)OCC(C(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C13H10F16O4/c1-6(2)30-3-4(31-6)7(15,16)5(14)32-13(28,29)9(19,11(23,24)25)33-12(26,27)8(17,18)10(20,21)22/h4-5H,3H2,1-2H3 |
| InChIKey | WGGCCJCJWZCNAR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.19 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|