C13H6F22O7 — CID 15472350
3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]butane-1,2-diol (PubChem CID 15472350) has the molecular formula C13H6F22O7 and a molecular weight of 692.14 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]butane-1,2-diol.
| Compound Name | 3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 15472350 |
| Molecular Formula | C13H6F22O7 |
| Molecular Weight | 692.14 g/mol |
| Exact Mass | 691.98 |
| IUPAC Name | 3,3,4-trifluoro-4-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]ethoxy]butane-1,2-diol |
| SMILES | OCC(O)C(F)(F)C(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C13H6F22O7/c14-3(4(15,16)2(37)1-36)38-5(17,18)6(19,20)39-7(21,22)8(23,24)40-9(25,26)10(27,28)41-11(29,30)12(31,32)42-13(33,34)35/h2-3,36-37H,1H2 |
| InChIKey | BEPAQPDTZBGSPP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.14 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|