C15H18O2 — CID 154723587
3-benzyl-3-prop-2-enylpentane-2,4-dione (PubChem CID 154723587) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-benzyl-3-prop-2-enylpentane-2,4-dione.
| Compound Name | 3-benzyl-3-prop-2-enylpentane-2,4-dione |
|---|---|
| PubChem CID | 154723587 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-benzyl-3-prop-2-enylpentane-2,4-dione |
| SMILES | C=CCC(Cc1ccccc1)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H18O2/c1-4-10-15(12(2)16,13(3)17)11-14-8-6-5-7-9-14/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | INRVXPAXWLPXDO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|