About 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole
2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole (PubChem CID 154724215) has the molecular formula C18H16Cl2N2O3S
and a molecular weight of 411.31 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole |
| PubChem CID | 154724215 |
| Molecular Formula | C18H16Cl2N2O3S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(c2nc3cc(Cl)cc(Cl)c3o2)CC1 |
| InChI | InChI=1S/C18H16Cl2N2O3S/c19-13-10-15(20)17-16(11-13)21-18(25-17)12-6-8-22(9-7-12)26(23,24)14-4-2-1-3-5-14/h1-5,10-12H,6-9H2 |
| InChIKey | PAMFHZRCFLDCOJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole?
The IUPAC name of 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole (CID 154724215) is 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole.
What is the SMILES notation for 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole?
The canonical SMILES for 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole is O=S(=O)(c1ccccc1)N1CCC(c2nc3cc(Cl)cc(Cl)c3o2)CC1.
What is the InChIKey of 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole?
The InChIKey is PAMFHZRCFLDCOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2O3S/c19-13-10-15(20)17-16(11-13)21-18(25-17)12-6-8-22(9-7-12)26(23,24)14-4-2-1-3-5-14/h1-5,10-12H,6-9H2.
What are the key properties of 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole?
2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole has a molecular weight of 411.31 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(benzenesulfonyl)piperidin-4-yl]-5,7-dichloro-1,3-benzoxazole is sourced from PubChem (CID 154724215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).