About [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate
[(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate (PubChem CID 154724247) has the molecular formula C22H16F2N2O4
and a molecular weight of 410.38 g/mol. Its IUPAC name is [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate.
Molecular Properties
| Compound Name | [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate |
| PubChem CID | 154724247 |
| Molecular Formula | C22H16F2N2O4 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate |
| SMILES | CC1(C)Cc2onc(-c3cccc(F)c3)c2C(=O)/C1=N\OC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H16F2N2O4/c1-22(2)11-16-17(18(25-29-16)12-5-3-7-14(23)9-12)19(27)20(22)26-30-21(28)13-6-4-8-15(24)10-13/h3-10H,11H2,1-2H3/b26-20+ |
| InChIKey | MCSZORNIXHBSHU-LHLOQNFPSA-N |
| XLogP | 4.60 |
| TPSA | 81.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate?
The IUPAC name of [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate (CID 154724247) is [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate.
What is the SMILES notation for [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate?
The canonical SMILES for [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate is CC1(C)Cc2onc(-c3cccc(F)c3)c2C(=O)/C1=N\OC(=O)c1cccc(F)c1.
What is the InChIKey of [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate?
The InChIKey is MCSZORNIXHBSHU-LHLOQNFPSA-N. The full InChI is InChI=1S/C22H16F2N2O4/c1-22(2)11-16-17(18(25-29-16)12-5-3-7-14(23)9-12)19(27)20(22)26-30-21(28)13-6-4-8-15(24)10-13/h3-10H,11H2,1-2H3/b26-20+.
What are the key properties of [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate?
[(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate has a molecular weight of 410.38 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[3-(3-fluorophenyl)-6,6-dimethyl-4-oxo-7H-1,2-benzoxazol-5-ylidene]amino] 3-fluorobenzoate is sourced from PubChem (CID 154724247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).