About 2-vinylcyclopropyl silane
2-vinylcyclopropyl silane (PubChem CID 154724301) has the molecular formula C5H7Si
and a molecular weight of 95.20 g/mol.
Molecular Properties
| Compound Name | 2-vinylcyclopropyl silane |
| PubChem CID | 154724301 |
| Molecular Formula | C5H7Si |
| Molecular Weight | 95.20 g/mol |
| Exact Mass | 95.03 |
| IUPAC Name | — |
| SMILES | C=CC1CC1[Si] |
| InChI | InChI=1S/C5H7Si/c1-2-4-3-5(4)6/h2,4-5H,1,3H2 |
| InChIKey | MOUMCQKKLCWNBP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-vinylcyclopropyl silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-vinylcyclopropyl silane?
The IUPAC name of 2-vinylcyclopropyl silane (CID 154724301) is not available.
What is the SMILES notation for 2-vinylcyclopropyl silane?
The canonical SMILES for 2-vinylcyclopropyl silane is C=CC1CC1[Si].
What is the InChIKey of 2-vinylcyclopropyl silane?
The InChIKey is MOUMCQKKLCWNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Si/c1-2-4-3-5(4)6/h2,4-5H,1,3H2.
What are the key properties of 2-vinylcyclopropyl silane?
2-vinylcyclopropyl silane has a molecular weight of 95.20 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-vinylcyclopropyl silane is sourced from PubChem (CID 154724301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).