About 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene
7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene (PubChem CID 154724452) has the molecular formula C11H11I
and a molecular weight of 270.11 g/mol. Its IUPAC name is 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene.
Molecular Properties
| Compound Name | 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene |
| PubChem CID | 154724452 |
| Molecular Formula | C11H11I |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene |
| SMILES | Ic1cccc2c1C1CC1CC2 |
| InChI | InChI=1S/C11H11I/c12-10-3-1-2-7-4-5-8-6-9(8)11(7)10/h1-3,8-9H,4-6H2 |
| InChIKey | ORADTRLIGBXLDB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene?
The IUPAC name of 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene (CID 154724452) is 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene.
What is the SMILES notation for 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene?
The canonical SMILES for 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene is Ic1cccc2c1C1CC1CC2.
What is the InChIKey of 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene?
The InChIKey is ORADTRLIGBXLDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11I/c12-10-3-1-2-7-4-5-8-6-9(8)11(7)10/h1-3,8-9H,4-6H2.
What are the key properties of 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene?
7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene has a molecular weight of 270.11 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalene is sourced from PubChem (CID 154724452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).