methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate

C4H3IN2O2S — CID 154724516

IUPACmethyl 5-iodo-1,2,4-thiadiazole-3-carboxylate
SMILESCOC(=O)c1nsc(I)n1
InChIInChI=1S/C4H3IN2O2S/c1-9-3(8)2-6-4(5)10-7-2/h1H3
InChIKeyNDZSGFNTZOOAIP-UHFFFAOYSA-N
MW270.05 g/mol
LogP0.93
Rot. Bonds1

About methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate

methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate (PubChem CID 154724516) has the molecular formula C4H3IN2O2S and a molecular weight of 270.05 g/mol. Its IUPAC name is methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 5-iodo-1,2,4-thiadiazole-3-carboxylate
PubChem CID154724516
Molecular FormulaC4H3IN2O2S
Molecular Weight270.05 g/mol
Exact Mass269.90
IUPAC Namemethyl 5-iodo-1,2,4-thiadiazole-3-carboxylate
SMILESCOC(=O)c1nsc(I)n1
InChIInChI=1S/C4H3IN2O2S/c1-9-3(8)2-6-4(5)10-7-2/h1H3
InChIKeyNDZSGFNTZOOAIP-UHFFFAOYSA-N
XLogP0.93
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.05
LogP ≤ 50.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate?
The IUPAC name of methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate (CID 154724516) is methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate.
What is the SMILES notation for methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate?
The canonical SMILES for methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate is COC(=O)c1nsc(I)n1.
What is the InChIKey of methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate?
The InChIKey is NDZSGFNTZOOAIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3IN2O2S/c1-9-3(8)2-6-4(5)10-7-2/h1H3.
What are the key properties of methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate?
methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate has a molecular weight of 270.05 g/mol, XLogP of 0.93, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-iodo-1,2,4-thiadiazole-3-carboxylate is sourced from PubChem (CID 154724516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).