C22H23NO2 — CID 154724836
benzyl (1S,3S,4R)-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 154724836) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is benzyl (1S,3S,4R)-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate.
| Compound Name | benzyl (1S,3S,4R)-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
|---|---|
| PubChem CID | 154724836 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | benzyl (1S,3S,4R)-2-[(1R)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1[C@@H]2C=C[C@@H](C2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO2/c1-16(18-10-6-3-7-11-18)23-20-13-12-19(14-20)21(23)22(24)25-15-17-8-4-2-5-9-17/h2-13,16,19-21H,14-15H2,1H3/t16-,19+,20-,21+/m1/s1 |
| InChIKey | BDONQSMSTJBYNI-RCOXNQKVSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|