C49H68O20S4 — CID 15472524
2-[2-[3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]-2,2-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 15472524) has the molecular formula C49H68O20S4 and a molecular weight of 1105.33 g/mol. Its IUPAC name is 2-[2-[3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]-2,2-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]-2,2-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15472524 |
| Molecular Formula | C49H68O20S4 |
| Molecular Weight | 1105.33 g/mol |
| Exact Mass | 1104.32 |
| IUPAC Name | 2-[2-[3-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]-2,2-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl]propoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCC(COCCOCCOS(=O)(=O)c2ccc(C)cc2)(COCCOCCOS(=O)(=O)c2ccc(C)cc2)COCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C49H68O20S4/c1-41-5-13-45(14-6-41)70(50,51)66-33-29-58-21-25-62-37-49(38-63-26-22-59-30-34-67-71(52,53)46-15-7-42(2)8-16-46,39-64-27-23-60-31-35-68-72(54,55)47-17-9-43(3)10-18-47)40-65-28-24-61-32-36-69-73(56,57)48-19-11-44(4)12-20-48/h5-20H,21-40H2,1-4H3 |
| InChIKey | IQIQAISOTCBYBC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 247.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|