C15H20ClN5O — CID 154725372
5-[[1-(2-chloroacetyl)piperidin-4-yl]amino]-6-(ethylamino)pyridine-3-carbonitrile (PubChem CID 154725372) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is 5-[[1-(2-chloroacetyl)piperidin-4-yl]amino]-6-(ethylamino)pyridine-3-carbonitrile.
| Compound Name | 5-[[1-(2-chloroacetyl)piperidin-4-yl]amino]-6-(ethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154725372 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-[[1-(2-chloroacetyl)piperidin-4-yl]amino]-6-(ethylamino)pyridine-3-carbonitrile |
| SMILES | CCNc1ncc(C#N)cc1NC1CCN(C(=O)CCl)CC1 |
| InChI | InChI=1S/C15H20ClN5O/c1-2-18-15-13(7-11(9-17)10-19-15)20-12-3-5-21(6-4-12)14(22)8-16/h7,10,12,20H,2-6,8H2,1H3,(H,18,19) |
| InChIKey | UNQJHPHYSIYKSQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|