C21H29N3O2S2 — CID 154725961
4-[4-[(4-thiophen-3-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfonamide (PubChem CID 154725961) has the molecular formula C21H29N3O2S2 and a molecular weight of 419.62 g/mol. Its IUPAC name is 4-[4-[(4-thiophen-3-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[(4-thiophen-3-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 154725961 |
| Molecular Formula | C21H29N3O2S2 |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-[4-[(4-thiophen-3-ylpiperidin-1-yl)methyl]piperidin-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCC(CN3CCC(c4ccsc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O2S2/c22-28(25,26)21-3-1-20(2-4-21)24-12-5-17(6-13-24)15-23-10-7-18(8-11-23)19-9-14-27-16-19/h1-4,9,14,16-18H,5-8,10-13,15H2,(H2,22,25,26) |
| InChIKey | UPHRDYNCPOVIFF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |