C9H10N6O — CID 154726104
2-amino-2-(6-cyano-3-pyridinyl)-N-(diaminomethylidene)acetamide (PubChem CID 154726104) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-amino-2-(6-cyano-3-pyridinyl)-N-(diaminomethylidene)acetamide.
| Compound Name | 2-amino-2-(6-cyano-3-pyridinyl)-N-(diaminomethylidene)acetamide |
|---|---|
| PubChem CID | 154726104 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-amino-2-(6-cyano-3-pyridinyl)-N-(diaminomethylidene)acetamide |
| SMILES | N#Cc1ccc(C(N)C(=O)N=C(N)N)cn1 |
| InChI | InChI=1S/C9H10N6O/c10-3-6-2-1-5(4-14-6)7(11)8(16)15-9(12)13/h1-2,4,7H,11H2,(H4,12,13,15,16) |
| InChIKey | GNJOWKTXFSHWBI-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|