About 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline
8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline (PubChem CID 154727170) has the molecular formula C9H3ClF2N2O2
and a molecular weight of 244.58 g/mol. Its IUPAC name is 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline.
Molecular Properties
| Compound Name | 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline |
| PubChem CID | 154727170 |
| Molecular Formula | C9H3ClF2N2O2 |
| Molecular Weight | 244.58 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline |
| SMILES | FC1(F)Oc2cc3ncnc(Cl)c3cc2O1 |
| InChI | InChI=1S/C9H3ClF2N2O2/c10-8-4-1-6-7(16-9(11,12)15-6)2-5(4)13-3-14-8/h1-3H |
| InChIKey | GLGPWSRJLYZZFD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline?
The IUPAC name of 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline (CID 154727170) is 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline.
What is the SMILES notation for 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline?
The canonical SMILES for 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline is FC1(F)Oc2cc3ncnc(Cl)c3cc2O1.
What is the InChIKey of 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline?
The InChIKey is GLGPWSRJLYZZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3ClF2N2O2/c10-8-4-1-6-7(16-9(11,12)15-6)2-5(4)13-3-14-8/h1-3H.
What are the key properties of 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline?
8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline has a molecular weight of 244.58 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2,2-difluoro-[1,3]dioxolo[4,5-g]quinazoline is sourced from PubChem (CID 154727170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).