About methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate
methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate (PubChem CID 154727766) has the molecular formula C15H15Cl2NO3
and a molecular weight of 328.20 g/mol. Its IUPAC name is methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate |
| PubChem CID | 154727766 |
| Molecular Formula | C15H15Cl2NO3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate |
| SMILES | COC(=O)C1CC2(C1)CC(C(=O)c1cc(Cl)nc(Cl)c1)C2 |
| InChI | InChI=1S/C15H15Cl2NO3/c1-21-14(20)10-6-15(7-10)4-9(5-15)13(19)8-2-11(16)18-12(17)3-8/h2-3,9-10H,4-7H2,1H3 |
| InChIKey | GPBAKQRFXPJSAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate?
The IUPAC name of methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate (CID 154727766) is methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate.
What is the SMILES notation for methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate?
The canonical SMILES for methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate is COC(=O)C1CC2(C1)CC(C(=O)c1cc(Cl)nc(Cl)c1)C2.
What is the InChIKey of methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate?
The InChIKey is GPBAKQRFXPJSAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Cl2NO3/c1-21-14(20)10-6-15(7-10)4-9(5-15)13(19)8-2-11(16)18-12(17)3-8/h2-3,9-10H,4-7H2,1H3.
What are the key properties of methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate?
methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate has a molecular weight of 328.20 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(2,6-dichloropyridine-4-carbonyl)spiro[3.3]heptane-2-carboxylate is sourced from PubChem (CID 154727766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).