C8H8IN3 — CID 154728389
6-iodo-2,8-dimethylimidazo[1,2-a]pyrazine (PubChem CID 154728389) has the molecular formula C8H8IN3 and a molecular weight of 273.08 g/mol. Its IUPAC name is 6-iodo-2,8-dimethylimidazo[1,2-a]pyrazine.
| Compound Name | 6-iodo-2,8-dimethylimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 154728389 |
| Molecular Formula | C8H8IN3 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 6-iodo-2,8-dimethylimidazo[1,2-a]pyrazine |
| SMILES | Cc1cn2cc(I)nc(C)c2n1 |
| InChI | InChI=1S/C8H8IN3/c1-5-3-12-4-7(9)11-6(2)8(12)10-5/h3-4H,1-2H3 |
| InChIKey | NAOUPHAXDFSBQY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|