C15H6Cl4F3NO4 — CID 154728700
(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate (PubChem CID 154728700) has the molecular formula C15H6Cl4F3NO4 and a molecular weight of 463.02 g/mol. Its IUPAC name is (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate.
| Compound Name | (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate |
|---|---|
| PubChem CID | 154728700 |
| Molecular Formula | C15H6Cl4F3NO4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | (4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl) 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylate |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1OC(=O)C12CC(C(F)(F)F)(C1)C2 |
| InChI | InChI=1S/C15H6Cl4F3NO4/c16-6-4-5(7(17)9(19)8(6)18)11(25)23(10(4)24)27-12(26)13-1-14(2-13,3-13)15(20,21)22/h1-3H2 |
| InChIKey | WXVLMVRDSVAUDG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|