C7H6ClN3O — CID 154728777
5-chloro-6-methoxy-1H-pyrazolo[4,3-b]pyridine (PubChem CID 154728777) has the molecular formula C7H6ClN3O and a molecular weight of 183.60 g/mol. Its IUPAC name is 5-chloro-6-methoxy-1H-pyrazolo[4,3-b]pyridine.
| Compound Name | 5-chloro-6-methoxy-1H-pyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 154728777 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 5-chloro-6-methoxy-1H-pyrazolo[4,3-b]pyridine |
| SMILES | COc1cc2[nH]ncc2nc1Cl |
| InChI | InChI=1S/C7H6ClN3O/c1-12-6-2-4-5(3-9-11-4)10-7(6)8/h2-3H,1H3,(H,9,11) |
| InChIKey | MBXNMFDREPLBEX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|