C23H24F6N2O4 — CID 154729248
5-[2-[3-amino-4-(2-ethenoxyethoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-ethenoxyethoxy)aniline (PubChem CID 154729248) has the molecular formula C23H24F6N2O4 and a molecular weight of 506.44 g/mol. Its IUPAC name is 5-[2-[3-amino-4-(2-ethenoxyethoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-ethenoxyethoxy)aniline.
| Compound Name | 5-[2-[3-amino-4-(2-ethenoxyethoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-ethenoxyethoxy)aniline |
|---|---|
| PubChem CID | 154729248 |
| Molecular Formula | C23H24F6N2O4 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 5-[2-[3-amino-4-(2-ethenoxyethoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(2-ethenoxyethoxy)aniline |
| SMILES | C=COCCOc1ccc(C(c2ccc(OCCOC=C)c(N)c2)(C(F)(F)F)C(F)(F)F)cc1N |
| InChI | InChI=1S/C23H24F6N2O4/c1-3-32-9-11-34-19-7-5-15(13-17(19)30)21(22(24,25)26,23(27,28)29)16-6-8-20(18(31)14-16)35-12-10-33-4-2/h3-8,13-14H,1-2,9-12,30-31H2 |
| InChIKey | AAPGZWQVGXAYSG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|