2,3-dibromo-5-chloropyridine-4-carboxylic acid

C6H2Br2ClNO2 — CID 154729339

IUPAC2,3-dibromo-5-chloropyridine-4-carboxylic acid
SMILESO=C(O)c1c(Cl)cnc(Br)c1Br
InChIInChI=1S/C6H2Br2ClNO2/c7-4-3(6(11)12)2(9)1-10-5(4)8/h1H,(H,11,12)
InChIKeyNLVSNKRORBVFFQ-UHFFFAOYSA-N
MW315.35 g/mol
LogP2.96
Rot. Bonds1

About 2,3-dibromo-5-chloropyridine-4-carboxylic acid

2,3-dibromo-5-chloropyridine-4-carboxylic acid (PubChem CID 154729339) has the molecular formula C6H2Br2ClNO2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 2,3-dibromo-5-chloropyridine-4-carboxylic acid.

Molecular Properties

Compound Name2,3-dibromo-5-chloropyridine-4-carboxylic acid
PubChem CID154729339
Molecular FormulaC6H2Br2ClNO2
Molecular Weight315.35 g/mol
Exact Mass312.81
IUPAC Name2,3-dibromo-5-chloropyridine-4-carboxylic acid
SMILESO=C(O)c1c(Cl)cnc(Br)c1Br
InChIInChI=1S/C6H2Br2ClNO2/c7-4-3(6(11)12)2(9)1-10-5(4)8/h1H,(H,11,12)
InChIKeyNLVSNKRORBVFFQ-UHFFFAOYSA-N
XLogP2.96
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.35
LogP ≤ 52.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 2,3-dibromo-5-chloropyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,5-dichloro-3-fluoropyridine-4-carboxylic acid
CID 11009178
4-bromo-2-chloro-5-(difluoromethyl)pyridine-3-carboxylic acid
CID 118845722
5-bromo-6-chloro-2,4-dimethylpyridine-3-carboxylic acid
CID 83668119
methyl 2-bromo-5-chloro-3-(dimethoxymethyl)pyridine-4-carboxylate
CID 170992761
2-bromo-5-fluoro-3-methylpyridine-4-carboxylic acid
CID 167728562
3-chloroquinoline-4-carboxylic acid
CID 22158738
2,5-dibromo-3-(difluoromethyl)pyridine-4-carboxylic acid
CID 119004021
2-bromo-5-(difluoromethyl)-4-fluoropyridine-3-carboxylic acid
CID 119024376
2-bromo-3-chloro-6-iodobenzoic acid
CID 131588144
6-chloro-[1,3]dioxolo[4,5-b]pyridine-7-carboxylic acid
CID 68548738
2-(bromomethyl)-5-chloro-4-(difluoromethyl)pyridine-3-carboxylic acid
CID 118849606
4-bromo-5-chloro-6-methylpyridine-3-carboxylic acid
CID 71757352

Frequently Asked Questions

What is the IUPAC name of 2,3-dibromo-5-chloropyridine-4-carboxylic acid?
The IUPAC name of 2,3-dibromo-5-chloropyridine-4-carboxylic acid (CID 154729339) is 2,3-dibromo-5-chloropyridine-4-carboxylic acid.
What is the SMILES notation for 2,3-dibromo-5-chloropyridine-4-carboxylic acid?
The canonical SMILES for 2,3-dibromo-5-chloropyridine-4-carboxylic acid is O=C(O)c1c(Cl)cnc(Br)c1Br.
What is the InChIKey of 2,3-dibromo-5-chloropyridine-4-carboxylic acid?
The InChIKey is NLVSNKRORBVFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Br2ClNO2/c7-4-3(6(11)12)2(9)1-10-5(4)8/h1H,(H,11,12).
What are the key properties of 2,3-dibromo-5-chloropyridine-4-carboxylic acid?
2,3-dibromo-5-chloropyridine-4-carboxylic acid has a molecular weight of 315.35 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-5-chloropyridine-4-carboxylic acid is sourced from PubChem (CID 154729339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).